C20H18Cl2N2O4S — CID 4969420
methyl 2-[4,6-bis(4-chlorophenyl)-6-hydroxy-1-methyl-2-sulfanylidene-1,3-diazinan-5-yl]-2-oxoacetate (PubChem CID 4969420) has the molecular formula C20H18Cl2N2O4S and a molecular weight of 453.35 g/mol. Its IUPAC name is methyl 2-[4,6-bis(4-chlorophenyl)-6-hydroxy-1-methyl-2-sulfanylidene-1,3-diazinan-5-yl]-2-oxoacetate.
| Compound Name | methyl 2-[4,6-bis(4-chlorophenyl)-6-hydroxy-1-methyl-2-sulfanylidene-1,3-diazinan-5-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 4969420 |
| Molecular Formula | C20H18Cl2N2O4S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | methyl 2-[4,6-bis(4-chlorophenyl)-6-hydroxy-1-methyl-2-sulfanylidene-1,3-diazinan-5-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)C1C(c2ccc(Cl)cc2)NC(=S)N(C)C1(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18Cl2N2O4S/c1-24-19(29)23-16(11-3-7-13(21)8-4-11)15(17(25)18(26)28-2)20(24,27)12-5-9-14(22)10-6-12/h3-10,15-16,27H,1-2H3,(H,23,29) |
| InChIKey | LANPLEMIQYLYRX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|