C20H15ClN2O2S — CID 4969541
5-(4-chlorophenyl)-4-(2-ethoxyphenoxy)thieno[2,3-d]pyrimidine (PubChem CID 4969541) has the molecular formula C20H15ClN2O2S and a molecular weight of 382.87 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-(2-ethoxyphenoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 5-(4-chlorophenyl)-4-(2-ethoxyphenoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 4969541 |
| Molecular Formula | C20H15ClN2O2S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 5-(4-chlorophenyl)-4-(2-ethoxyphenoxy)thieno[2,3-d]pyrimidine |
| SMILES | CCOc1ccccc1Oc1ncnc2scc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C20H15ClN2O2S/c1-2-24-16-5-3-4-6-17(16)25-19-18-15(11-26-20(18)23-12-22-19)13-7-9-14(21)10-8-13/h3-12H,2H2,1H3 |
| InChIKey | RFBCDTNROMAFME-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |