C22H25N5 — CID 4969783
11,13-dimethyl-N-(2-phenylethyl)-4-propyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-amine (PubChem CID 4969783) has the molecular formula C22H25N5 and a molecular weight of 359.48 g/mol. Its IUPAC name is 11,13-dimethyl-N-(2-phenylethyl)-4-propyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-amine.
| Compound Name | 11,13-dimethyl-N-(2-phenylethyl)-4-propyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 4969783 |
| Molecular Formula | C22H25N5 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 11,13-dimethyl-N-(2-phenylethyl)-4-propyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-amine |
| SMILES | CCCc1cc(NCCc2ccccc2)n2nc3nc(C)cc(C)c3c2n1 |
| InChI | InChI=1S/C22H25N5/c1-4-8-18-14-19(23-12-11-17-9-6-5-7-10-17)27-22(25-18)20-15(2)13-16(3)24-21(20)26-27/h5-7,9-10,13-14,23H,4,8,11-12H2,1-3H3 |
| InChIKey | NLVVBBSIKBYYHI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |