C23H22ClN3O3 — CID 4970230
6'-chloro-1,7'-dimethyl-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 4970230) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is 6'-chloro-1,7'-dimethyl-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 6'-chloro-1,7'-dimethyl-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4970230 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 6'-chloro-1,7'-dimethyl-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | Cc1c(Cl)ccc2c1NC(=O)C21NC(C)C2C(=O)N(CCc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C23H22ClN3O3/c1-12-16(24)9-8-15-19(12)25-22(30)23(15)18-17(13(2)26-23)20(28)27(21(18)29)11-10-14-6-4-3-5-7-14/h3-9,13,17-18,26H,10-11H2,1-2H3,(H,25,30) |
| InChIKey | GBGSKFICBJTIME-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|