C16H13Br2NO2 — CID 4970471
5-[(2,4-dibromophenoxy)methyl]-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 4970471) has the molecular formula C16H13Br2NO2 and a molecular weight of 411.09 g/mol. Its IUPAC name is 5-[(2,4-dibromophenoxy)methyl]-3-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-[(2,4-dibromophenoxy)methyl]-3-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 4970471 |
| Molecular Formula | C16H13Br2NO2 |
| Molecular Weight | 411.09 g/mol |
| Exact Mass | 408.93 |
| IUPAC Name | 5-[(2,4-dibromophenoxy)methyl]-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | Brc1ccc(OCC2CC(c3ccccc3)=NO2)c(Br)c1 |
| InChI | InChI=1S/C16H13Br2NO2/c17-12-6-7-16(14(18)8-12)20-10-13-9-15(19-21-13)11-4-2-1-3-5-11/h1-8,13H,9-10H2 |
| InChIKey | WUGZIMYAWOZRQM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.09 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |