About N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide
N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide (PubChem CID 4970557) has the molecular formula C19H15N3O4
and a molecular weight of 349.35 g/mol. Its IUPAC name is N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide.
Molecular Properties
| Compound Name | N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide |
| PubChem CID | 4970557 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide |
| SMILES | Cc1ccc(OCc2occc2C(=O)Nc2cccc3nonc23)cc1 |
| InChI | InChI=1S/C19H15N3O4/c1-12-5-7-13(8-6-12)25-11-17-14(9-10-24-17)19(23)20-15-3-2-4-16-18(15)22-26-21-16/h2-10H,11H2,1H3,(H,20,23) |
| InChIKey | AGJJRSXPOQJOFM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide?
The IUPAC name of N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide (CID 4970557) is N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide.
What is the SMILES notation for N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide?
The canonical SMILES for N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide is Cc1ccc(OCc2occc2C(=O)Nc2cccc3nonc23)cc1.
What is the InChIKey of N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide?
The InChIKey is AGJJRSXPOQJOFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O4/c1-12-5-7-13(8-6-12)25-11-17-14(9-10-24-17)19(23)20-15-3-2-4-16-18(15)22-26-21-16/h2-10H,11H2,1H3,(H,20,23).
What are the key properties of N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide?
N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide has a molecular weight of 349.35 g/mol, XLogP of 3.96, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,1,3-benzoxadiazol-4-yl)-2-[(4-methylphenoxy)methyl]furan-3-carboxamide is sourced from PubChem (CID 4970557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).