C11H15N — CID 49719
2-Ethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 49719) has the molecular formula C11H15N and a molecular weight of 161.24 g/mol. Its IUPAC name is 2-ethyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-Ethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 49719 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2-ethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CCN1CCC2=CC=CC=C2C1 |
| InChI | InChI=1S/C11H15N/c1-2-12-8-7-10-5-3-4-6-11(10)9-12/h3-6H,2,7-9H2,1H3 |
| InChIKey | VFCWGXGWQPTGNQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 144 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |