C28H32N6O6 — CID 4972261
7'-[(1-cyclohexyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylideneamino]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4972261) has the molecular formula C28H32N6O6 and a molecular weight of 548.60 g/mol. Its IUPAC name is 7'-[(1-cyclohexyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylideneamino]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 7'-[(1-cyclohexyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylideneamino]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4972261 |
| Molecular Formula | C28H32N6O6 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 7'-[(1-cyclohexyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylideneamino]-1,3-dimethylspiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CN1C(=O)N(C)C(=O)C2(Cc3cc(/N=C/c4c(O)n(C5CCCCC5)c(=O)[nH]c4=O)ccc3N3CCCC32)C1=O |
| InChI | InChI=1S/C28H32N6O6/c1-31-24(37)28(25(38)32(2)27(31)40)14-16-13-17(10-11-20(16)33-12-6-9-21(28)33)29-15-19-22(35)30-26(39)34(23(19)36)18-7-4-3-5-8-18/h10-11,13,15,18,21,36H,3-9,12,14H2,1-2H3,(H,30,35,39)/b29-15+ |
| InChIKey | VISOOAMKVSQHSM-WKULSOCRSA-N |
| XLogP | 2.06 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|