C9H8N4O3 — CID 4972760
4,7-dimethylpurino[8,7-b][1,3]oxazole-1,3-dione (PubChem CID 4972760) has the molecular formula C9H8N4O3 and a molecular weight of 220.19 g/mol. Its IUPAC name is 4,7-dimethylpurino[8,7-b][1,3]oxazole-1,3-dione.
| Compound Name | 4,7-dimethylpurino[8,7-b][1,3]oxazole-1,3-dione |
|---|---|
| PubChem CID | 4972760 |
| Molecular Formula | C9H8N4O3 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 4,7-dimethylpurino[8,7-b][1,3]oxazole-1,3-dione |
| SMILES | Cc1cn2c(nc3c2c(=O)[nH]c(=O)n3C)o1 |
| InChI | InChI=1S/C9H8N4O3/c1-4-3-13-5-6(10-9(13)16-4)12(2)8(15)11-7(5)14/h3H,1-2H3,(H,11,14,15) |
| InChIKey | PKMWGPVJJVDQSB-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |