C16H20N2O4S2 — CID 4973108
N-[3-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylpropanamide (PubChem CID 4973108) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylpropanamide.
| Compound Name | N-[3-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylpropanamide |
|---|---|
| PubChem CID | 4973108 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[3-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylpropanamide |
| SMILES | COc1ccc(N2/C(=N/C(=O)C(C)C)SC3CS(=O)(=O)CC32)cc1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-10(2)15(19)17-16-18(11-4-6-12(22-3)7-5-11)13-8-24(20,21)9-14(13)23-16/h4-7,10,13-14H,8-9H2,1-3H3/b17-16- |
| InChIKey | NAFDKXQTFKMFDO-MSUUIHNZSA-N |
| XLogP | 1.95 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|