C21H36N2O — CID 4973317
N-[3-(2,2-dimethyloxan-4-yl)-3-(4-methylphenyl)propyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 4973317) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is N-[3-(2,2-dimethyloxan-4-yl)-3-(4-methylphenyl)propyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[3-(2,2-dimethyloxan-4-yl)-3-(4-methylphenyl)propyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 4973317 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | N-[3-(2,2-dimethyloxan-4-yl)-3-(4-methylphenyl)propyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | Cc1ccc(C(CCNCCN(C)C)C2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C21H36N2O/c1-17-6-8-18(9-7-17)20(10-12-22-13-14-23(4)5)19-11-15-24-21(2,3)16-19/h6-9,19-20,22H,10-16H2,1-5H3 |
| InChIKey | OFXYFIUSQDZZBQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|