C28H25ClN4O3 — CID 4973572
7'-chloro-3'-methyl-1,3-diphenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4973572) has the molecular formula C28H25ClN4O3 and a molecular weight of 500.99 g/mol. Its IUPAC name is 7'-chloro-3'-methyl-1,3-diphenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 7'-chloro-3'-methyl-1,3-diphenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4973572 |
| Molecular Formula | C28H25ClN4O3 |
| Molecular Weight | 500.99 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 7'-chloro-3'-methyl-1,3-diphenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CN1CCN2c3cccc(Cl)c3CC3(C(=O)N(c4ccccc4)C(=O)N(c4ccccc4)C3=O)C2C1 |
| InChI | InChI=1S/C28H25ClN4O3/c1-30-15-16-31-23-14-8-13-22(29)21(23)17-28(24(31)18-30)25(34)32(19-9-4-2-5-10-19)27(36)33(26(28)35)20-11-6-3-7-12-20/h2-14,24H,15-18H2,1H3 |
| InChIKey | MPKAMOVOVCXYNH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.99 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|