C16H25N3OS — CID 4974141
6-pentyl-7-piperidin-1-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 4974141) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 6-pentyl-7-piperidin-1-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 6-pentyl-7-piperidin-1-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 4974141 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 6-pentyl-7-piperidin-1-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCCc1c(N2CCCCC2)nc2n(c1=O)CCS2 |
| InChI | InChI=1S/C16H25N3OS/c1-2-3-5-8-13-14(18-9-6-4-7-10-18)17-16-19(15(13)20)11-12-21-16/h2-12H2,1H3 |
| InChIKey | SNYQAROLVDNJNM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|