C19H19N5OS — CID 4974463
7-anilino-11,11-dimethyl-5-methylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 4974463) has the molecular formula C19H19N5OS and a molecular weight of 365.46 g/mol. Its IUPAC name is 7-anilino-11,11-dimethyl-5-methylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 7-anilino-11,11-dimethyl-5-methylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 4974463 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 7-anilino-11,11-dimethyl-5-methylsulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | CSc1nnc2c3c(c(C#N)c(Nc4ccccc4)n12)CC(C)(C)OC3 |
| InChI | InChI=1S/C19H19N5OS/c1-19(2)9-13-14(10-20)16(21-12-7-5-4-6-8-12)24-17(15(13)11-25-19)22-23-18(24)26-3/h4-8,21H,9,11H2,1-3H3 |
| InChIKey | YPNSSFIFPFWVTI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |