C21H20N2O4 — CID 4974634
2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 4974634) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 4974634 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | CC(Oc1ccc2c3c(c(=O)oc2c1)CCC3)C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C21H20N2O4/c1-13(20(24)23-12-14-7-9-22-10-8-14)26-15-5-6-17-16-3-2-4-18(16)21(25)27-19(17)11-15/h5-11,13H,2-4,12H2,1H3,(H,23,24) |
| InChIKey | XZPNUABEDXXCGD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|