C17H27N3OS — CID 4974916
7-pentyl-8-piperidin-1-yl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one (PubChem CID 4974916) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 7-pentyl-8-piperidin-1-yl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one.
| Compound Name | 7-pentyl-8-piperidin-1-yl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one |
|---|---|
| PubChem CID | 4974916 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 7-pentyl-8-piperidin-1-yl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one |
| SMILES | CCCCCc1c(N2CCCCC2)nc2n(c1=O)CCCS2 |
| InChI | InChI=1S/C17H27N3OS/c1-2-3-5-9-14-15(19-10-6-4-7-11-19)18-17-20(16(14)21)12-8-13-22-17/h2-13H2,1H3 |
| InChIKey | RDNQEXUYEBFAIK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|