C17H28N4OS — CID 4975036
7-pentyl-8-(piperidin-1-ylamino)-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one (PubChem CID 4975036) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is 7-pentyl-8-(piperidin-1-ylamino)-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one.
| Compound Name | 7-pentyl-8-(piperidin-1-ylamino)-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one |
|---|---|
| PubChem CID | 4975036 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 7-pentyl-8-(piperidin-1-ylamino)-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one |
| SMILES | CCCCCc1c(NN2CCCCC2)nc2n(c1=O)CCCS2 |
| InChI | InChI=1S/C17H28N4OS/c1-2-3-5-9-14-15(19-20-10-6-4-7-11-20)18-17-21(16(14)22)12-8-13-23-17/h19H,2-13H2,1H3 |
| InChIKey | RLOPWDHNIVTEAY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|