About 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile
2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile (PubChem CID 4975154) has the molecular formula C17H18N4O2S
and a molecular weight of 342.42 g/mol. Its IUPAC name is 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile |
| PubChem CID | 4975154 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile |
| SMILES | COc1cc(C2C(C#N)=C(N)SC(N)=C2C#N)ccc1OC(C)C |
| InChI | InChI=1S/C17H18N4O2S/c1-9(2)23-13-5-4-10(6-14(13)22-3)15-11(7-18)16(20)24-17(21)12(15)8-19/h4-6,9,15H,20-21H2,1-3H3 |
| InChIKey | FHQPQINOOIFDPJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dhp_bis_amino_CN(19)', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile?
The IUPAC name of 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile (CID 4975154) is 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile.
What is the SMILES notation for 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile?
The canonical SMILES for 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile is COc1cc(C2C(C#N)=C(N)SC(N)=C2C#N)ccc1OC(C)C.
What is the InChIKey of 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile?
The InChIKey is FHQPQINOOIFDPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O2S/c1-9(2)23-13-5-4-10(6-14(13)22-3)15-11(7-18)16(20)24-17(21)12(15)8-19/h4-6,9,15H,20-21H2,1-3H3.
What are the key properties of 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile?
2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile has a molecular weight of 342.42 g/mol, XLogP of 2.70, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diamino-4-(3-methoxy-4-propan-2-yloxyphenyl)-4H-thiopyran-3,5-dicarbonitrile is sourced from PubChem (CID 4975154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).