C20H18F3N3O4 — CID 4975370
N-[1-[2-(3,4-dihydroxyphenyl)ethyl]-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]acetamide (PubChem CID 4975370) has the molecular formula C20H18F3N3O4 and a molecular weight of 421.38 g/mol. Its IUPAC name is N-[1-[2-(3,4-dihydroxyphenyl)ethyl]-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]acetamide.
| Compound Name | N-[1-[2-(3,4-dihydroxyphenyl)ethyl]-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]acetamide |
|---|---|
| PubChem CID | 4975370 |
| Molecular Formula | C20H18F3N3O4 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[1-[2-(3,4-dihydroxyphenyl)ethyl]-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]acetamide |
| SMILES | CC(=O)NC1(C(F)(F)F)N=C(c2ccccc2)N(CCc2ccc(O)c(O)c2)C1=O |
| InChI | InChI=1S/C20H18F3N3O4/c1-12(27)24-19(20(21,22)23)18(30)26(17(25-19)14-5-3-2-4-6-14)10-9-13-7-8-15(28)16(29)11-13/h2-8,11,28-29H,9-10H2,1H3,(H,24,27) |
| InChIKey | JUIZVCFNSMISOC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|