C26H31N3O4 — CID 4975415
N-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)cyclohexyl]methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 4975415) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)cyclohexyl]methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | N-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)cyclohexyl]methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4975415 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-[[4-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)cyclohexyl]methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)C1CCC(CNC(=O)C2Cc3ccccc3CN2)CC1 |
| InChI | InChI=1S/C26H31N3O4/c30-25(29-21-9-10-23-24(14-21)33-12-11-32-23)18-7-5-17(6-8-18)15-28-26(31)22-13-19-3-1-2-4-20(19)16-27-22/h1-4,9-10,14,17-18,22,27H,5-8,11-13,15-16H2,(H,28,31)(H,29,30) |
| InChIKey | PJVKHLYIIQDCEK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |