C26H30N6O6 — CID 4975467
1,3,3'-trimethyl-8'-[(2,4,6-trioxo-1-propyl-1,3-diazinan-5-ylidene)methyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4975467) has the molecular formula C26H30N6O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is 1,3,3'-trimethyl-8'-[(2,4,6-trioxo-1-propyl-1,3-diazinan-5-ylidene)methyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 1,3,3'-trimethyl-8'-[(2,4,6-trioxo-1-propyl-1,3-diazinan-5-ylidene)methyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4975467 |
| Molecular Formula | C26H30N6O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 1,3,3'-trimethyl-8'-[(2,4,6-trioxo-1-propyl-1,3-diazinan-5-ylidene)methyl]spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CCCN1C(=O)NC(=O)C(=Cc2ccc3c(c2)CC2(C(=O)N(C)C(=O)N(C)C2=O)C2CN(C)CCN32)C1=O |
| InChI | InChI=1S/C26H30N6O6/c1-5-8-32-21(34)17(20(33)27-24(32)37)12-15-6-7-18-16(11-15)13-26(19-14-28(2)9-10-31(18)19)22(35)29(3)25(38)30(4)23(26)36/h6-7,11-12,19H,5,8-10,13-14H2,1-4H3,(H,27,33,37) |
| InChIKey | ASSLEEJVAOWINN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|