C24H18N2O5 — CID 4975674
2-(5-methyl-1,2-oxazol-3-yl)-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4975674) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-(5-methyl-1,2-oxazol-3-yl)-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(5-methyl-1,2-oxazol-3-yl)-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4975674 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-(5-methyl-1,2-oxazol-3-yl)-1-(3-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1cccc(C2c3c(oc4ccccc4c3=O)C(=O)N2c2cc(C)on2)c1 |
| InChI | InChI=1S/C24H18N2O5/c1-3-11-29-16-8-6-7-15(13-16)21-20-22(27)17-9-4-5-10-18(17)30-23(20)24(28)26(21)19-12-14(2)31-25-19/h3-10,12-13,21H,1,11H2,2H3 |
| InChIKey | MWDXPQSKADUFNU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|