C16H15BrN2O6S — CID 4975724
1-[2-[5-[(5-bromofuran-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-4-carboxylic acid (PubChem CID 4975724) has the molecular formula C16H15BrN2O6S and a molecular weight of 443.28 g/mol. Its IUPAC name is 1-[2-[5-[(5-bromofuran-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[5-[(5-bromofuran-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4975724 |
| Molecular Formula | C16H15BrN2O6S |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 1-[2-[5-[(5-bromofuran-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)CN2C(=O)SC(=Cc3ccc(Br)o3)C2=O)CC1 |
| InChI | InChI=1S/C16H15BrN2O6S/c17-12-2-1-10(25-12)7-11-14(21)19(16(24)26-11)8-13(20)18-5-3-9(4-6-18)15(22)23/h1-2,7,9H,3-6,8H2,(H,22,23) |
| InChIKey | MBHPMQYITLDZPY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|