C22H26FN3O3 — CID 4976086
[4-(2-fluorophenyl)piperazin-1-yl]-(4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-yl)methanone (PubChem CID 4976086) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-(4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-yl)methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-(4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 4976086 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-(4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCN(c3ccccc3F)CC2)oc2c1C(=NO)CC(C)(C)C2 |
| InChI | InChI=1S/C22H26FN3O3/c1-14-19-16(24-28)12-22(2,3)13-18(19)29-20(14)21(27)26-10-8-25(9-11-26)17-7-5-4-6-15(17)23/h4-7,28H,8-13H2,1-3H3 |
| InChIKey | HBRHRGAUMLKZHV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|