C18H22N4O — CID 4976121
3-[(7-benzyl-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)amino]propan-1-ol (PubChem CID 4976121) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-[(7-benzyl-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)amino]propan-1-ol.
| Compound Name | 3-[(7-benzyl-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 4976121 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3-[(7-benzyl-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)amino]propan-1-ol |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ncnc(NCCCO)c12 |
| InChI | InChI=1S/C18H22N4O/c1-13-14(2)22(11-15-7-4-3-5-8-15)18-16(13)17(20-12-21-18)19-9-6-10-23/h3-5,7-8,12,23H,6,9-11H2,1-2H3,(H,19,20,21) |
| InChIKey | NBOLQHCXMYRMID-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|