C26H22N6O4S — CID 4976208
7-anilino-11,11-dimethyl-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 4976208) has the molecular formula C26H22N6O4S and a molecular weight of 514.57 g/mol. Its IUPAC name is 7-anilino-11,11-dimethyl-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 7-anilino-11,11-dimethyl-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 4976208 |
| Molecular Formula | C26H22N6O4S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 7-anilino-11,11-dimethyl-5-[2-(3-nitrophenyl)-2-oxoethyl]sulfanyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | CC1(C)Cc2c(C#N)c(Nc3ccccc3)n3c(SCC(=O)c4cccc([N+](=O)[O-])c4)nnc3c2CO1 |
| InChI | InChI=1S/C26H22N6O4S/c1-26(2)12-19-20(13-27)23(28-17-8-4-3-5-9-17)31-24(21(19)14-36-26)29-30-25(31)37-15-22(33)16-7-6-10-18(11-16)32(34)35/h3-11,28H,12,14-15H2,1-2H3 |
| InChIKey | GHQOTLCCGVNIBD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|