About 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol
4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol (PubChem CID 4977447) has the molecular formula C13H14NOS3+
and a molecular weight of 296.46 g/mol. Its IUPAC name is 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol.
Molecular Properties
| Compound Name | 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol |
| PubChem CID | 4977447 |
| Molecular Formula | C13H14NOS3+ |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol |
| SMILES | CSc1[s+]sc2c1-c1cc(O)ccc1NC2(C)C |
| InChI | InChI=1S/C13H13NOS3/c1-13(2)11-10(12(16-3)18-17-11)8-6-7(15)4-5-9(8)14-13/h4-6,14H,1-3H3/p+1 |
| InChIKey | GEZCYRJOZNSNCV-UHFFFAOYSA-O |
| XLogP | 4.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol?
The IUPAC name of 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol (CID 4977447) is 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol.
What is the SMILES notation for 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol?
The canonical SMILES for 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol is CSc1[s+]sc2c1-c1cc(O)ccc1NC2(C)C.
What is the InChIKey of 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol?
The InChIKey is GEZCYRJOZNSNCV-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H13NOS3/c1-13(2)11-10(12(16-3)18-17-11)8-6-7(15)4-5-9(8)14-13/h4-6,14H,1-3H3/p+1.
What are the key properties of 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol?
4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol has a molecular weight of 296.46 g/mol, XLogP of 4.85, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1-methylsulfanyl-5H-dithiolo[3,4-c]quinolin-2-ium-8-ol is sourced from PubChem (CID 4977447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).