C17H28N2O4 — CID 4977840
3-(2-hydroxy-3-morpholin-4-ylpropyl)-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 4977840) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 3-(2-hydroxy-3-morpholin-4-ylpropyl)-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(2-hydroxy-3-morpholin-4-ylpropyl)-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 4977840 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 3-(2-hydroxy-3-morpholin-4-ylpropyl)-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC12CCC(C(=O)N(CC(O)CN3CCOCC3)C1=O)C2(C)C |
| InChI | InChI=1S/C17H28N2O4/c1-16(2)13-4-5-17(16,3)15(22)19(14(13)21)11-12(20)10-18-6-8-23-9-7-18/h12-13,20H,4-11H2,1-3H3 |
| InChIKey | ZUVQPSTUHKYASO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|