C27H20FN2PS — CID 4978470
3-(4-fluorophenyl)-1,4,6-triphenyl-4-sulfanylidene-1,2,4λ5-diazaphosphinine (PubChem CID 4978470) has the molecular formula C27H20FN2PS and a molecular weight of 454.51 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1,4,6-triphenyl-4-sulfanylidene-1,2,4λ5-diazaphosphinine.
| Compound Name | 3-(4-fluorophenyl)-1,4,6-triphenyl-4-sulfanylidene-1,2,4λ5-diazaphosphinine |
|---|---|
| PubChem CID | 4978470 |
| Molecular Formula | C27H20FN2PS |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 3-(4-fluorophenyl)-1,4,6-triphenyl-4-sulfanylidene-1,2,4λ5-diazaphosphinine |
| SMILES | Fc1ccc(C2=NN(c3ccccc3)C(c3ccccc3)=CP2(=S)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H20FN2PS/c28-23-18-16-22(17-19-23)27-29-30(24-12-6-2-7-13-24)26(21-10-4-1-5-11-21)20-31(27,32)25-14-8-3-9-15-25/h1-20H |
| InChIKey | AFAKWNOROGZDOD-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|