About 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile
4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile (PubChem CID 4979098) has the molecular formula C14H20N3+
and a molecular weight of 230.34 g/mol. Its IUPAC name is 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile |
| PubChem CID | 4979098 |
| Molecular Formula | C14H20N3+ |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile |
| SMILES | CC1C(c2ccccc2)[NH+](C)CCC1(N)C#N |
| InChI | InChI=1S/C14H19N3/c1-11-13(12-6-4-3-5-7-12)17(2)9-8-14(11,16)10-15/h3-7,11,13H,8-9,16H2,1-2H3/p+1 |
| InChIKey | QSGWCWGBPKZDJJ-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile?
The IUPAC name of 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile (CID 4979098) is 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile.
What is the SMILES notation for 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile?
The canonical SMILES for 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile is CC1C(c2ccccc2)[NH+](C)CCC1(N)C#N.
What is the InChIKey of 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile?
The InChIKey is QSGWCWGBPKZDJJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H19N3/c1-11-13(12-6-4-3-5-7-12)17(2)9-8-14(11,16)10-15/h3-7,11,13H,8-9,16H2,1-2H3/p+1.
What are the key properties of 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile?
4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile has a molecular weight of 230.34 g/mol, XLogP of 0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,3-dimethyl-2-phenylpiperidin-1-ium-4-carbonitrile is sourced from PubChem (CID 4979098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).