About N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide
N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide (PubChem CID 4979291) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide |
| PubChem CID | 4979291 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide |
| SMILES | CC(=O)NC1CNC(=O)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2/c1-13(21)20-16-12-19-17(22)18(16,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16H,12H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | SZSGFTRZERGBRP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide?
The IUPAC name of N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide (CID 4979291) is N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide.
What is the SMILES notation for N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide?
The canonical SMILES for N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide is CC(=O)NC1CNC(=O)C1(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide?
The InChIKey is SZSGFTRZERGBRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-13(21)20-16-12-19-17(22)18(16,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16H,12H2,1H3,(H,19,22)(H,20,21).
What are the key properties of N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide?
N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide has a molecular weight of 294.35 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-oxo-4,4-diphenylpyrrolidin-3-yl)acetamide is sourced from PubChem (CID 4979291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).