C44H58O4 — CID 4979313
(10-benzoyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picen-4a-yl)methyl benzoate (PubChem CID 4979313) has the molecular formula C44H58O4 and a molecular weight of 650.94 g/mol. Its IUPAC name is (10-benzoyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picen-4a-yl)methyl benzoate.
| Compound Name | (10-benzoyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picen-4a-yl)methyl benzoate |
|---|---|
| PubChem CID | 4979313 |
| Molecular Formula | C44H58O4 |
| Molecular Weight | 650.94 g/mol |
| Exact Mass | 650.43 |
| IUPAC Name | (10-benzoyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picen-4a-yl)methyl benzoate |
| SMILES | CC1CCC2(COC(=O)c3ccccc3)CCC3(C)C(=CCC4C5(C)CCC(OC(=O)c6ccccc6)C(C)(C)C5CCC43C)C2C1C |
| InChI | InChI=1S/C44H58O4/c1-29-20-25-44(28-47-38(45)31-14-10-8-11-15-31)27-26-42(6)33(37(44)30(29)2)18-19-35-41(5)23-22-36(48-39(46)32-16-12-9-13-17-32)40(3,4)34(41)21-24-43(35,42)7/h8-18,29-30,34-37H,19-28H2,1-7H3 |
| InChIKey | RRXJKSJXHMFJEA-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.94 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|