C36H46N2O13 — CID 4979472
tert-butyl 2-[[2-[[6-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carbonyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoate (PubChem CID 4979472) has the molecular formula C36H46N2O13 and a molecular weight of 714.77 g/mol. Its IUPAC name is tert-butyl 2-[[2-[[6-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carbonyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoate.
| Compound Name | tert-butyl 2-[[2-[[6-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carbonyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 4979472 |
| Molecular Formula | C36H46N2O13 |
| Molecular Weight | 714.77 g/mol |
| Exact Mass | 714.30 |
| IUPAC Name | tert-butyl 2-[[2-[[6-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carbonyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C1OC(Oc2cc3oc(-c4ccccc4)cc(=O)c3c(O)c2O)C(O)C(O)C1O)C(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H46N2O13/c1-16(2)13-19(34(47)51-36(5,6)7)37-32(45)25(17(3)4)38-33(46)31-29(43)28(42)30(44)35(50-31)49-23-15-22-24(27(41)26(23)40)20(39)14-21(48-22)18-11-9-8-10-12-18/h8-12,14-17,19,25,28-31,35,40-44H,13H2,1-7H3,(H,37,45)(H,38,46) |
| InChIKey | GOOFZOQDLIMARN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 234.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.77 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|