About 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate
2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate (PubChem CID 4979738) has the molecular formula C16H16FN5O4
and a molecular weight of 361.33 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate.
Molecular Properties
| Compound Name | 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate |
| PubChem CID | 4979738 |
| Molecular Formula | C16H16FN5O4 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate |
| SMILES | Cn1c(=O)c2[nH]c(NCCOC(=O)c3ccc(F)cc3)nc2n(C)c1=O |
| InChI | InChI=1S/C16H16FN5O4/c1-21-12-11(13(23)22(2)16(21)25)19-15(20-12)18-7-8-26-14(24)9-3-5-10(17)6-4-9/h3-6H,7-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | NJAWKRLDVRXORR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate?
The IUPAC name of 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate (CID 4979738) is 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate.
What is the SMILES notation for 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate?
The canonical SMILES for 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate is Cn1c(=O)c2[nH]c(NCCOC(=O)c3ccc(F)cc3)nc2n(C)c1=O.
What is the InChIKey of 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate?
The InChIKey is NJAWKRLDVRXORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN5O4/c1-21-12-11(13(23)22(2)16(21)25)19-15(20-12)18-7-8-26-14(24)9-3-5-10(17)6-4-9/h3-6H,7-8H2,1-2H3,(H2,18,19,20).
What are the key properties of 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate?
2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate has a molecular weight of 361.33 g/mol, XLogP of 0.37, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)amino]ethyl 4-fluorobenzoate is sourced from PubChem (CID 4979738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).