C22H24N2O3 — CID 49805859
1,3-Bis(3-phenylpropyl)-1,3-diazinane-2,4,6-trione (PubChem CID 49805859) has the molecular formula C22H24N2O3 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1,3-bis(3-phenylpropyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-Bis(3-phenylpropyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 49805859 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1,3-bis(3-phenylpropyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C1C(=O)N(C(=O)N(C1=O)CCCC2=CC=CC=C2)CCCC3=CC=CC=C3 |
| InChI | InChI=1S/C22H24N2O3/c25-20-17-21(26)24(16-8-14-19-11-5-2-6-12-19)22(27)23(20)15-7-13-18-9-3-1-4-10-18/h1-6,9-12H,7-8,13-17H2 |
| InChIKey | KEKHWOBKEZUIPS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | 478 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|