C23H25ClO2S — CID 4981199
(2,4-ditert-butylphenyl) 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 4981199) has the molecular formula C23H25ClO2S and a molecular weight of 400.97 g/mol. Its IUPAC name is (2,4-ditert-butylphenyl) 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | (2,4-ditert-butylphenyl) 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4981199 |
| Molecular Formula | C23H25ClO2S |
| Molecular Weight | 400.97 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (2,4-ditert-butylphenyl) 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CC(C)(C)c1ccc(OC(=O)c2sc3ccccc3c2Cl)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H25ClO2S/c1-22(2,3)14-11-12-17(16(13-14)23(4,5)6)26-21(25)20-19(24)15-9-7-8-10-18(15)27-20/h7-13H,1-6H3 |
| InChIKey | PCFVJTLSHOAJDD-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.97 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|