C20H22N2O2 — CID 4982210
N-[(2-methyl-1-phenylpropylidene)amino]-4-prop-2-enoxybenzamide (PubChem CID 4982210) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[(2-methyl-1-phenylpropylidene)amino]-4-prop-2-enoxybenzamide.
| Compound Name | N-[(2-methyl-1-phenylpropylidene)amino]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 4982210 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-[(2-methyl-1-phenylpropylidene)amino]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NN=C(c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-4-14-24-18-12-10-17(11-13-18)20(23)22-21-19(15(2)3)16-8-6-5-7-9-16/h4-13,15H,1,14H2,2-3H3,(H,22,23) |
| InChIKey | DWRNBKRDOZVYQS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|