C32H35N3O6S2 — CID 4982907
ethyl 2-[[2-[1-[2-[(3,4-dimethoxybenzoyl)amino]ethyl]indol-3-yl]sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4982907) has the molecular formula C32H35N3O6S2 and a molecular weight of 621.78 g/mol. Its IUPAC name is ethyl 2-[[2-[1-[2-[(3,4-dimethoxybenzoyl)amino]ethyl]indol-3-yl]sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[1-[2-[(3,4-dimethoxybenzoyl)amino]ethyl]indol-3-yl]sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4982907 |
| Molecular Formula | C32H35N3O6S2 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | ethyl 2-[[2-[1-[2-[(3,4-dimethoxybenzoyl)amino]ethyl]indol-3-yl]sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2cn(CCNC(=O)c3ccc(OC)c(OC)c3)c3ccccc23)sc2c1CCCC2 |
| InChI | InChI=1S/C32H35N3O6S2/c1-4-41-32(38)29-22-10-6-8-12-26(22)43-31(29)34-28(36)19-42-27-18-35(23-11-7-5-9-21(23)27)16-15-33-30(37)20-13-14-24(39-2)25(17-20)40-3/h5,7,9,11,13-14,17-18H,4,6,8,10,12,15-16,19H2,1-3H3,(H,33,37)(H,34,36) |
| InChIKey | XDCUVRFDHJLEOG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |