C34H27F3N2O6 — CID 4982995
5-benzyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 4982995) has the molecular formula C34H27F3N2O6 and a molecular weight of 616.59 g/mol. Its IUPAC name is 5-benzyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 4982995 |
| Molecular Formula | C34H27F3N2O6 |
| Molecular Weight | 616.59 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 5-benzyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1-[3-[3-(trifluoromethyl)phenoxy]phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C1C2C(c3cccc(Oc4cccc(C(F)(F)F)c4)c3)NC(Cc3ccc(O)cc3)(C(=O)O)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C34H27F3N2O6/c35-34(36,37)23-9-5-11-26(17-23)45-25-10-4-8-22(16-25)29-27-28(31(42)39(30(27)41)19-21-6-2-1-3-7-21)33(38-29,32(43)44)18-20-12-14-24(40)15-13-20/h1-17,27-29,38,40H,18-19H2,(H,43,44) |
| InChIKey | GYESEBVKELMTRU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|