C28H41N3O5S — CID 4983176
2-[2-(2,5-dimethoxyanilino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N,N-diethylacetamide (PubChem CID 4983176) has the molecular formula C28H41N3O5S and a molecular weight of 531.72 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyanilino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N,N-diethylacetamide.
| Compound Name | 2-[2-(2,5-dimethoxyanilino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 4983176 |
| Molecular Formula | C28H41N3O5S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 2-[2-(2,5-dimethoxyanilino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CC1c2nc(Nc3cc(OC)ccc3OC)sc2CC2C(C)(CO)C(O)CCC12C |
| InChI | InChI=1S/C28H41N3O5S/c1-7-31(8-2)24(34)14-18-25-21(15-22-27(18,3)12-11-23(33)28(22,4)16-32)37-26(30-25)29-19-13-17(35-5)9-10-20(19)36-6/h9-10,13,18,22-23,32-33H,7-8,11-12,14-16H2,1-6H3,(H,29,30) |
| InChIKey | SLHDWFNUIGCOGC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |