C19H13ClFN3O2 — CID 49836516
2-(2-Chlorophenyl)-4-(2-fluorophenyl)-5-methyl-1h-pyrazolo[4,3-c]pyridine-3,6(2h,5h)-dione (PubChem CID 49836516) has the molecular formula C19H13ClFN3O2 and a molecular weight of 369.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-(2-fluorophenyl)-5-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 2-(2-Chlorophenyl)-4-(2-fluorophenyl)-5-methyl-1h-pyrazolo[4,3-c]pyridine-3,6(2h,5h)-dione |
|---|---|
| PubChem CID | 49836516 |
| Molecular Formula | C19H13ClFN3O2 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-(2-chlorophenyl)-4-(2-fluorophenyl)-5-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | CN1C(=O)C=C2C(=C1C3=CC=CC=C3F)C(=O)N(N2)C4=CC=CC=C4Cl |
| InChI | InChI=1S/C19H13ClFN3O2/c1-23-16(25)10-14-17(18(23)11-6-2-4-8-13(11)21)19(26)24(22-14)15-9-5-3-7-12(15)20/h2-10,22H,1H3 |
| InChIKey | KJQWOWLDTVSADY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | 692 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|