C10H17N3 — CID 4984094
3-azido-1,3,5,5-tetramethylcyclohexene (PubChem CID 4984094) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 3-azido-1,3,5,5-tetramethylcyclohexene.
| Compound Name | 3-azido-1,3,5,5-tetramethylcyclohexene |
|---|---|
| PubChem CID | 4984094 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 3-azido-1,3,5,5-tetramethylcyclohexene |
| SMILES | CC1=CC(C)(N=[N+]=[N-])CC(C)(C)C1 |
| InChI | InChI=1S/C10H17N3/c1-8-5-9(2,3)7-10(4,6-8)12-13-11/h6H,5,7H2,1-4H3 |
| InChIKey | XIDIQKPVLJRPQI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|