C13H18O6 — CID 4984739
2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol (PubChem CID 4984739) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 4984739 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol |
| SMILES | OCC1OC(OCc2ccccc2)C(O)C(O)C1O |
| InChI | InChI=1S/C13H18O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2 |
| InChIKey | GKHCBYYBLTXYEV-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |