C28H29FN6O3S — CID 4985228
ethyl 1-[2-[2-[[5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]amino]ethylamino]quinazolin-4-yl]piperidine-3-carboxylate (PubChem CID 4985228) has the molecular formula C28H29FN6O3S and a molecular weight of 548.64 g/mol. Its IUPAC name is ethyl 1-[2-[2-[[5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]amino]ethylamino]quinazolin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[2-[[5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]amino]ethylamino]quinazolin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 4985228 |
| Molecular Formula | C28H29FN6O3S |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | ethyl 1-[2-[2-[[5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]amino]ethylamino]quinazolin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2nc(NCCNC(=O)c3ncsc3-c3cccc(F)c3)nc3ccccc23)C1 |
| InChI | InChI=1S/C28H29FN6O3S/c1-2-38-27(37)19-8-6-14-35(16-19)25-21-10-3-4-11-22(21)33-28(34-25)31-13-12-30-26(36)23-24(39-17-32-23)18-7-5-9-20(29)15-18/h3-5,7,9-11,15,17,19H,2,6,8,12-14,16H2,1H3,(H,30,36)(H,31,33,34) |
| InChIKey | HSHJELMHTUKXDW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|