About Ala-Gly-Val
Ala-Gly-Val (PubChem CID 49864477) has the molecular formula C10H19N3O4
and a molecular weight of 245.28 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | Ala-Gly-Val |
| PubChem CID | 49864477 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-3-methylbutanoic acid |
| SMILES | C[C@@H](C(=O)NCC(=O)N[C@@H](C(C)C)C(=O)O)N |
| InChI | InChI=1S/C10H19N3O4/c1-5(2)8(10(16)17)13-7(14)4-12-9(15)6(3)11/h5-6,8H,4,11H2,1-3H3,(H,12,15)(H,13,14)(H,16,17)/t6-,8-/m0/s1 |
| InChIKey | SMCGQGDVTPFXKB-XPUUQOCRSA-N |
| XLogP | -3.50 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | 304 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Ala-Gly-Val with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ala-Gly-Val?
The IUPAC name of Ala-Gly-Val (CID 49864477) is (2S)-2-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-3-methylbutanoic acid.
What is the SMILES notation for Ala-Gly-Val?
The canonical SMILES for Ala-Gly-Val is C[C@@H](C(=O)NCC(=O)N[C@@H](C(C)C)C(=O)O)N.
What is the InChIKey of Ala-Gly-Val?
The InChIKey is SMCGQGDVTPFXKB-XPUUQOCRSA-N. The full InChI is InChI=1S/C10H19N3O4/c1-5(2)8(10(16)17)13-7(14)4-12-9(15)6(3)11/h5-6,8H,4,11H2,1-3H3,(H,12,15)(H,13,14)(H,16,17)/t6-,8-/m0/s1.
What are the key properties of Ala-Gly-Val?
Ala-Gly-Val has a molecular weight of 245.28 g/mol, XLogP of -3.50, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Ala-Gly-Val is sourced from PubChem (CID 49864477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).