C27H22N2O4S — CID 4986490
N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]-N-(4-methoxyphenyl)thiophene-2-carboxamide (PubChem CID 4986490) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]-N-(4-methoxyphenyl)thiophene-2-carboxamide.
| Compound Name | N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]-N-(4-methoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4986490 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]-N-(4-methoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1ccc(N(CCCN2C(=O)c3cccc4cccc(c34)C2=O)C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C27H22N2O4S/c1-33-20-13-11-19(12-14-20)28(27(32)23-10-4-17-34-23)15-5-16-29-25(30)21-8-2-6-18-7-3-9-22(24(18)21)26(29)31/h2-4,6-14,17H,5,15-16H2,1H3 |
| InChIKey | UCXWAMKRFSPWCE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|