About [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone
[6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone (PubChem CID 4986508) has the molecular formula C16H21ClN4O
and a molecular weight of 320.82 g/mol. Its IUPAC name is [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone |
| PubChem CID | 4986508 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CCCC(C)N1C(=O)c1cc2ncc(CCCl)cn2n1 |
| InChI | InChI=1S/C16H21ClN4O/c1-11-4-3-5-12(2)21(11)16(22)14-8-15-18-9-13(6-7-17)10-20(15)19-14/h8-12H,3-7H2,1-2H3 |
| InChIKey | KGRFGARPBAOETG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone?
The IUPAC name of [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone (CID 4986508) is [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone.
What is the SMILES notation for [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone?
The canonical SMILES for [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone is CC1CCCC(C)N1C(=O)c1cc2ncc(CCCl)cn2n1.
What is the InChIKey of [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone?
The InChIKey is KGRFGARPBAOETG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClN4O/c1-11-4-3-5-12(2)21(11)16(22)14-8-15-18-9-13(6-7-17)10-20(15)19-14/h8-12H,3-7H2,1-2H3.
What are the key properties of [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone?
[6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone has a molecular weight of 320.82 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2-chloroethyl)pyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone is sourced from PubChem (CID 4986508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).