About Chromophore (Gly-Tyr-Gly)
Chromophore (Gly-Tyr-Gly) (PubChem CID 49866829) has the molecular formula C15H17N3O5
and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[(4Z)-2-[(1R,2R)-1-amino-2-hydroxypropyl]-4-[(4-hydroxyphenyl)methylidene]-5-oxoimidazol-1-yl]acetic acid.
Molecular Properties
| Compound Name | Chromophore (Gly-Tyr-Gly) |
| PubChem CID | 49866829 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[(4Z)-2-[(1R,2R)-1-amino-2-hydroxypropyl]-4-[(4-hydroxyphenyl)methylidene]-5-oxoimidazol-1-yl]acetic acid |
| SMILES | C[C@H]([C@@H](C1=N/C(=C\C2=CC=C(C=C2)O)/C(=O)N1CC(=O)O)N)O |
| InChI | InChI=1S/C15H17N3O5/c1-8(19)13(16)14-17-11(15(23)18(14)7-12(21)22)6-9-2-4-10(20)5-3-9/h2-6,8,13,19-20H,7,16H2,1H3,(H,21,22)/b11-6-/t8-,13+/m1/s1 |
| InChIKey | UZCDFHUXSDKGEZ-NGDPAIJVSA-N |
| XLogP | -2.70 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | 537 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze Chromophore (Gly-Tyr-Gly) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Chromophore (Gly-Tyr-Gly)?
The IUPAC name of Chromophore (Gly-Tyr-Gly) (CID 49866829) is 2-[(4Z)-2-[(1R,2R)-1-amino-2-hydroxypropyl]-4-[(4-hydroxyphenyl)methylidene]-5-oxoimidazol-1-yl]acetic acid.
What is the SMILES notation for Chromophore (Gly-Tyr-Gly)?
The canonical SMILES for Chromophore (Gly-Tyr-Gly) is C[C@H]([C@@H](C1=N/C(=C\C2=CC=C(C=C2)O)/C(=O)N1CC(=O)O)N)O.
What is the InChIKey of Chromophore (Gly-Tyr-Gly)?
The InChIKey is UZCDFHUXSDKGEZ-NGDPAIJVSA-N. The full InChI is InChI=1S/C15H17N3O5/c1-8(19)13(16)14-17-11(15(23)18(14)7-12(21)22)6-9-2-4-10(20)5-3-9/h2-6,8,13,19-20H,7,16H2,1H3,(H,21,22)/b11-6-/t8-,13+/m1/s1.
What are the key properties of Chromophore (Gly-Tyr-Gly)?
Chromophore (Gly-Tyr-Gly) has a molecular weight of 319.31 g/mol, XLogP of -2.70, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Chromophore (Gly-Tyr-Gly) is sourced from PubChem (CID 49866829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).