C28H32N8O2S2 — CID 4986873
2-[[6-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide (PubChem CID 4986873) has the molecular formula C28H32N8O2S2 and a molecular weight of 576.75 g/mol. Its IUPAC name is 2-[[6-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[[6-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 4986873 |
| Molecular Formula | C28H32N8O2S2 |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 2-[[6-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(CSc1nc2ccc(Nc3nc(N4CCCC4)nc(N4CCCC4)n3)cc2s1)NCCOc1ccccc1 |
| InChI | InChI=1S/C28H32N8O2S2/c37-24(29-12-17-38-21-8-2-1-3-9-21)19-39-28-31-22-11-10-20(18-23(22)40-28)30-25-32-26(35-13-4-5-14-35)34-27(33-25)36-15-6-7-16-36/h1-3,8-11,18H,4-7,12-17,19H2,(H,29,37)(H,30,32,33,34) |
| InChIKey | VXQGPJJFWZFMCP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|