C41H60N4O6 — CID 4987801
1-[[2-[4-[(6-acetamidohexanoylamino)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide (PubChem CID 4987801) has the molecular formula C41H60N4O6 and a molecular weight of 704.95 g/mol. Its IUPAC name is 1-[[2-[4-[(6-acetamidohexanoylamino)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide.
| Compound Name | 1-[[2-[4-[(6-acetamidohexanoylamino)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 4987801 |
| Molecular Formula | C41H60N4O6 |
| Molecular Weight | 704.95 g/mol |
| Exact Mass | 704.45 |
| IUPAC Name | 1-[[2-[4-[(6-acetamidohexanoylamino)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1ccc(C2OC(CN3C(C(=O)NC(C)(C)C)CCC4CCCCC43)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C41H60N4O6/c1-28(47)42-23-9-5-6-12-38(48)43-25-29-13-19-33(20-14-29)40-50-34(24-37(51-40)32-17-15-30(27-46)16-18-32)26-45-35-11-8-7-10-31(35)21-22-36(45)39(49)44-41(2,3)4/h13-20,31,34-37,40,46H,5-12,21-27H2,1-4H3,(H,42,47)(H,43,48)(H,44,49) |
| InChIKey | CTOVLVRYRSZKGR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.95 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|